C17H17BrF2N2O2 — CID 166323733
2-amino-2-(3-bromophenyl)-N-[2-(3,4-difluorophenoxy)ethyl]propanamide (PubChem CID 166323733) has the molecular formula C17H17BrF2N2O2 and a molecular weight of 399.24 g/mol. Its IUPAC name is 2-amino-2-(3-bromophenyl)-N-[2-(3,4-difluorophenoxy)ethyl]propanamide.
| Compound Name | 2-amino-2-(3-bromophenyl)-N-[2-(3,4-difluorophenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 166323733 |
| Molecular Formula | C17H17BrF2N2O2 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | 2-amino-2-(3-bromophenyl)-N-[2-(3,4-difluorophenoxy)ethyl]propanamide |
| SMILES | CC(N)(C(=O)NCCOc1ccc(F)c(F)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H17BrF2N2O2/c1-17(21,11-3-2-4-12(18)9-11)16(23)22-7-8-24-13-5-6-14(19)15(20)10-13/h2-6,9-10H,7-8,21H2,1H3,(H,22,23) |
| InChIKey | XLGVKTFYOKYIOK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|