C17H22BrNO3 — CID 171078312
methyl 2-(3-bromophenyl)-4-(2-cyano-2-methylpropoxy)-2-methylbutanoate (PubChem CID 171078312) has the molecular formula C17H22BrNO3 and a molecular weight of 368.27 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-4-(2-cyano-2-methylpropoxy)-2-methylbutanoate.
| Compound Name | methyl 2-(3-bromophenyl)-4-(2-cyano-2-methylpropoxy)-2-methylbutanoate |
|---|---|
| PubChem CID | 171078312 |
| Molecular Formula | C17H22BrNO3 |
| Molecular Weight | 368.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | methyl 2-(3-bromophenyl)-4-(2-cyano-2-methylpropoxy)-2-methylbutanoate |
| SMILES | COC(=O)C(C)(CCOCC(C)(C)C#N)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H22BrNO3/c1-16(2,11-19)12-22-9-8-17(3,15(20)21-4)13-6-5-7-14(18)10-13/h5-7,10H,8-9,12H2,1-4H3 |
| InChIKey | RVFYKJNINRRHEJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|