C16H18Br2O3 — CID 171078696
1-bromo-3-(3-bromophenyl)-3-methyl-4-(2-prop-2-ynoxyethoxy)butan-2-one (PubChem CID 171078696) has the molecular formula C16H18Br2O3 and a molecular weight of 418.13 g/mol. Its IUPAC name is 1-bromo-3-(3-bromophenyl)-3-methyl-4-(2-prop-2-ynoxyethoxy)butan-2-one.
| Compound Name | 1-bromo-3-(3-bromophenyl)-3-methyl-4-(2-prop-2-ynoxyethoxy)butan-2-one |
|---|---|
| PubChem CID | 171078696 |
| Molecular Formula | C16H18Br2O3 |
| Molecular Weight | 418.13 g/mol |
| Exact Mass | 415.96 |
| IUPAC Name | 1-bromo-3-(3-bromophenyl)-3-methyl-4-(2-prop-2-ynoxyethoxy)butan-2-one |
| SMILES | C#CCOCCOCC(C)(C(=O)CBr)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H18Br2O3/c1-3-7-20-8-9-21-12-16(2,15(19)11-17)13-5-4-6-14(18)10-13/h1,4-6,10H,7-9,11-12H2,2H3 |
| InChIKey | JSMHGNBNLMGWRG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|