C17H21BrO3 — CID 159432290
tert-butyl 3-(3-bromophenyl)-4-hydroxy-3-methylhex-5-ynoate (PubChem CID 159432290) has the molecular formula C17H21BrO3 and a molecular weight of 353.26 g/mol. Its IUPAC name is tert-butyl 3-(3-bromophenyl)-4-hydroxy-3-methylhex-5-ynoate.
| Compound Name | tert-butyl 3-(3-bromophenyl)-4-hydroxy-3-methylhex-5-ynoate |
|---|---|
| PubChem CID | 159432290 |
| Molecular Formula | C17H21BrO3 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | tert-butyl 3-(3-bromophenyl)-4-hydroxy-3-methylhex-5-ynoate |
| SMILES | C#CC(O)C(C)(CC(=O)OC(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H21BrO3/c1-6-14(19)17(5,11-15(20)21-16(2,3)4)12-8-7-9-13(18)10-12/h1,7-10,14,19H,11H2,2-5H3 |
| InChIKey | LRDFAZNIVOZEQP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|