C25H39BrN2O3SSi — CID 171077562
methyl 2-(3-bromophenyl)-2-methyl-5-[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propan-2-ylsulfanyl]pentanoate (PubChem CID 171077562) has the molecular formula C25H39BrN2O3SSi and a molecular weight of 555.66 g/mol. Its IUPAC name is methyl 2-(3-bromophenyl)-2-methyl-5-[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propan-2-ylsulfanyl]pentanoate.
| Compound Name | methyl 2-(3-bromophenyl)-2-methyl-5-[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propan-2-ylsulfanyl]pentanoate |
|---|---|
| PubChem CID | 171077562 |
| Molecular Formula | C25H39BrN2O3SSi |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 554.16 |
| IUPAC Name | methyl 2-(3-bromophenyl)-2-methyl-5-[2-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]propan-2-ylsulfanyl]pentanoate |
| SMILES | COC(=O)C(C)(CCCSC(C)(C)c1cnn(COCC[Si](C)(C)C)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C25H39BrN2O3SSi/c1-24(2,21-17-27-28(18-21)19-31-13-15-33(5,6)7)32-14-9-12-25(3,23(29)30-4)20-10-8-11-22(26)16-20/h8,10-11,16-18H,9,12-15,19H2,1-7H3 |
| InChIKey | FBLRDNNFFOOSGX-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|