C40H56O7SSi — CID 171077891
7-[2-[tert-butyl(diphenyl)silyl]oxyethylsulfonyl]-2-[3-(4-methoxy-3-methyl-4-oxobutyl)phenyl]-2,6,6-trimethylheptanoic acid (PubChem CID 171077891) has the molecular formula C40H56O7SSi and a molecular weight of 709.03 g/mol. Its IUPAC name is 7-[2-[tert-butyl(diphenyl)silyl]oxyethylsulfonyl]-2-[3-(4-methoxy-3-methyl-4-oxobutyl)phenyl]-2,6,6-trimethylheptanoic acid.
| Compound Name | 7-[2-[tert-butyl(diphenyl)silyl]oxyethylsulfonyl]-2-[3-(4-methoxy-3-methyl-4-oxobutyl)phenyl]-2,6,6-trimethylheptanoic acid |
|---|---|
| PubChem CID | 171077891 |
| Molecular Formula | C40H56O7SSi |
| Molecular Weight | 709.03 g/mol |
| Exact Mass | 708.35 |
| IUPAC Name | 7-[2-[tert-butyl(diphenyl)silyl]oxyethylsulfonyl]-2-[3-(4-methoxy-3-methyl-4-oxobutyl)phenyl]-2,6,6-trimethylheptanoic acid |
| SMILES | COC(=O)C(C)CCc1cccc(C(C)(CCCC(C)(C)CS(=O)(=O)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C40H56O7SSi/c1-31(36(41)46-8)23-24-32-17-15-18-33(29-32)40(7,37(42)43)26-16-25-39(5,6)30-48(44,45)28-27-47-49(38(2,3)4,34-19-11-9-12-20-34)35-21-13-10-14-22-35/h9-15,17-22,29,31H,16,23-28,30H2,1-8H3,(H,42,43) |
| InChIKey | XHAJIJNRTCAURV-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.03 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|