C33H50O5SSi — CID 171076994
benzyl (2R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-2-(3-ethenylphenyl)-2,6,6-trimethylheptanoate (PubChem CID 171076994) has the molecular formula C33H50O5SSi and a molecular weight of 586.91 g/mol. Its IUPAC name is benzyl (2R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-2-(3-ethenylphenyl)-2,6,6-trimethylheptanoate.
| Compound Name | benzyl (2R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-2-(3-ethenylphenyl)-2,6,6-trimethylheptanoate |
|---|---|
| PubChem CID | 171076994 |
| Molecular Formula | C33H50O5SSi |
| Molecular Weight | 586.91 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | benzyl (2R)-7-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfonyl]-2-(3-ethenylphenyl)-2,6,6-trimethylheptanoate |
| SMILES | C=Cc1cccc([C@@](C)(CCCC(C)(C)CS(=O)(=O)CCO[Si](C)(C)C(C)(C)C)C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C33H50O5SSi/c1-10-27-18-14-19-29(24-27)33(7,30(34)37-25-28-16-12-11-13-17-28)21-15-20-32(5,6)26-39(35,36)23-22-38-40(8,9)31(2,3)4/h10-14,16-19,24H,1,15,20-23,25-26H2,2-9H3/t33-/m1/s1 |
| InChIKey | IPRKFONSLBEFDE-MGBGTMOVSA-N |
| XLogP | 7.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.91 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|