C24H39NO3Si — CID 45102918
benzyl N-[(4R)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]-N-prop-2-enylcarbamate (PubChem CID 45102918) has the molecular formula C24H39NO3Si and a molecular weight of 417.67 g/mol. Its IUPAC name is benzyl N-[(4R)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | benzyl N-[(4R)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 45102918 |
| Molecular Formula | C24H39NO3Si |
| Molecular Weight | 417.67 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | benzyl N-[(4R)-7-[tert-butyl(dimethyl)silyl]oxyhept-1-en-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CC[C@@H](CCCO[Si](C)(C)C(C)(C)C)N(CC=C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H39NO3Si/c1-8-14-22(17-13-19-28-29(6,7)24(3,4)5)25(18-9-2)23(26)27-20-21-15-11-10-12-16-21/h8-12,15-16,22H,1-2,13-14,17-20H2,3-7H3/t22-/m0/s1 |
| InChIKey | JNGOFVINLPQDTC-QFIPXVFZSA-N |
| XLogP | 6.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.67 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|