C21H34O3S — CID 171076026
tert-butyl 7-(2-hydroxyethylsulfanyl)-2-methyl-2-(3-methylphenyl)heptanoate (PubChem CID 171076026) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is tert-butyl 7-(2-hydroxyethylsulfanyl)-2-methyl-2-(3-methylphenyl)heptanoate.
| Compound Name | tert-butyl 7-(2-hydroxyethylsulfanyl)-2-methyl-2-(3-methylphenyl)heptanoate |
|---|---|
| PubChem CID | 171076026 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | tert-butyl 7-(2-hydroxyethylsulfanyl)-2-methyl-2-(3-methylphenyl)heptanoate |
| SMILES | Cc1cccc(C(C)(CCCCCSCCO)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C21H34O3S/c1-17-10-9-11-18(16-17)21(5,19(23)24-20(2,3)4)12-7-6-8-14-25-15-13-22/h9-11,16,22H,6-8,12-15H2,1-5H3 |
| InChIKey | QESNDMUCFCKTEK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|