C22H35NO4 — CID 171078584
ethane;methyl 2-methyl-7-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)-2-(3-methylphenyl)heptanoate (PubChem CID 171078584) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is ethane;methyl 2-methyl-7-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)-2-(3-methylphenyl)heptanoate.
| Compound Name | ethane;methyl 2-methyl-7-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)-2-(3-methylphenyl)heptanoate |
|---|---|
| PubChem CID | 171078584 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | ethane;methyl 2-methyl-7-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)-2-(3-methylphenyl)heptanoate |
| SMILES | CC.COC(=O)C(C)(CCCCCC1CN(C)C(=O)O1)c1cccc(C)c1 |
| InChI | InChI=1S/C20H29NO4.C2H6/c1-15-9-8-10-16(13-15)20(2,18(22)24-4)12-7-5-6-11-17-14-21(3)19(23)25-17;1-2/h8-10,13,17H,5-7,11-12,14H2,1-4H3;1-2H3 |
| InChIKey | DAKJTXBKBYBMSV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|