C19H31Cl2N3O3 — CID 19811467
5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-methyl-1,3-oxazolidin-2-one;dihydrochloride (PubChem CID 19811467) has the molecular formula C19H31Cl2N3O3 and a molecular weight of 420.38 g/mol. Its IUPAC name is 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-methyl-1,3-oxazolidin-2-one;dihydrochloride.
| Compound Name | 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-methyl-1,3-oxazolidin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 19811467 |
| Molecular Formula | C19H31Cl2N3O3 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 5-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]-3-methyl-1,3-oxazolidin-2-one;dihydrochloride |
| SMILES | COc1ccccc1N1CCN(CCCCC2CN(C)C(=O)O2)CC1.Cl.Cl |
| InChI | InChI=1S/C19H29N3O3.2ClH/c1-20-15-16(25-19(20)23)7-5-6-10-21-11-13-22(14-12-21)17-8-3-4-9-18(17)24-2;;/h3-4,8-9,16H,5-7,10-15H2,1-2H3;2*1H |
| InChIKey | DGIKUDZPGXNKDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|