C20H29NO4 — CID 171078731
2,7-dimethyl-2-(3-methylphenyl)-7-(2-oxo-1,3-oxazolidin-5-yl)octanoic acid (PubChem CID 171078731) has the molecular formula C20H29NO4 and a molecular weight of 347.45 g/mol. Its IUPAC name is 2,7-dimethyl-2-(3-methylphenyl)-7-(2-oxo-1,3-oxazolidin-5-yl)octanoic acid.
| Compound Name | 2,7-dimethyl-2-(3-methylphenyl)-7-(2-oxo-1,3-oxazolidin-5-yl)octanoic acid |
|---|---|
| PubChem CID | 171078731 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2,7-dimethyl-2-(3-methylphenyl)-7-(2-oxo-1,3-oxazolidin-5-yl)octanoic acid |
| SMILES | Cc1cccc(C(C)(CCCCC(C)(C)C2CNC(=O)O2)C(=O)O)c1 |
| InChI | InChI=1S/C20H29NO4/c1-14-8-7-9-15(12-14)20(4,17(22)23)11-6-5-10-19(2,3)16-13-21-18(24)25-16/h7-9,12,16H,5-6,10-11,13H2,1-4H3,(H,21,24)(H,22,23) |
| InChIKey | DTHNCXSYGHZTEQ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|