C20H29BrO — CID 171079168
1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane (PubChem CID 171079168) has the molecular formula C20H29BrO and a molecular weight of 365.36 g/mol. Its IUPAC name is 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane.
| Compound Name | 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane |
|---|---|
| PubChem CID | 171079168 |
| Molecular Formula | C20H29BrO |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane |
| SMILES | C#CCCCCC(C)(C(=O)CBr)c1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C18H23BrO.C2H6/c1-5-6-7-8-11-18(4,17(20)13-19)16-10-9-14(2)15(3)12-16;1-2/h1,9-10,12H,6-8,11,13H2,2-4H3;1-2H3 |
| InChIKey | JNWGICRKOQYCMB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|