About 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane
1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane (PubChem CID 171079168) has the molecular formula C20H29BrO
and a molecular weight of 365.36 g/mol. Its IUPAC name is 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane.
Molecular Properties
| Compound Name | 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane |
| PubChem CID | 171079168 |
| Molecular Formula | C20H29BrO |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane |
| SMILES | C#CCCCCC(C)(C(=O)CBr)c1ccc(C)c(C)c1.CC |
| InChI | InChI=1S/C18H23BrO.C2H6/c1-5-6-7-8-11-18(4,17(20)13-19)16-10-9-14(2)15(3)12-16;1-2/h1,9-10,12H,6-8,11,13H2,2-4H3;1-2H3 |
| InChIKey | JNWGICRKOQYCMB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane?
The IUPAC name of 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane (CID 171079168) is 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane.
What is the SMILES notation for 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane?
The canonical SMILES for 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane is C#CCCCCC(C)(C(=O)CBr)c1ccc(C)c(C)c1.CC.
What is the InChIKey of 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane?
The InChIKey is JNWGICRKOQYCMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23BrO.C2H6/c1-5-6-7-8-11-18(4,17(20)13-19)16-10-9-14(2)15(3)12-16;1-2/h1,9-10,12H,6-8,11,13H2,2-4H3;1-2H3.
What are the key properties of 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane?
1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane has a molecular weight of 365.36 g/mol, XLogP of 5.74, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-(3,4-dimethylphenyl)-3-methylnon-8-yn-2-one;ethane is sourced from PubChem (CID 171079168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).