C11H9BrF3NO4 — CID 21204889
methyl 2-[(3-bromobenzoyl)amino]-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 21204889) has the molecular formula C11H9BrF3NO4 and a molecular weight of 356.09 g/mol. Its IUPAC name is methyl 2-[(3-bromobenzoyl)amino]-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | methyl 2-[(3-bromobenzoyl)amino]-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 21204889 |
| Molecular Formula | C11H9BrF3NO4 |
| Molecular Weight | 356.09 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | methyl 2-[(3-bromobenzoyl)amino]-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | COC(=O)C(O)(NC(=O)c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C11H9BrF3NO4/c1-20-9(18)10(19,11(13,14)15)16-8(17)6-3-2-4-7(12)5-6/h2-5,19H,1H3,(H,16,17) |
| InChIKey | YPBMOZPTZDPKAV-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.09 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|