C12H12F3NO4 — CID 2729370
methyl 3,3,3-trifluoro-2-hydroxy-2-[(4-methylbenzoyl)amino]propanoate (PubChem CID 2729370) has the molecular formula C12H12F3NO4 and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-hydroxy-2-[(4-methylbenzoyl)amino]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-hydroxy-2-[(4-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 2729370 |
| Molecular Formula | C12H12F3NO4 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-hydroxy-2-[(4-methylbenzoyl)amino]propanoate |
| SMILES | COC(=O)C(O)(NC(=O)c1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO4/c1-7-3-5-8(6-4-7)9(17)16-11(19,10(18)20-2)12(13,14)15/h3-6,19H,1-2H3,(H,16,17) |
| InChIKey | VJYCNVIORVXITP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|