C16H16F3N3O3 — CID 7289973
methyl (2R,3R)-3-cyano-4-imino-2-[(4-methylbenzoyl)amino]-2-(trifluoromethyl)pentanoate (PubChem CID 7289973) has the molecular formula C16H16F3N3O3 and a molecular weight of 355.32 g/mol. Its IUPAC name is methyl (2R,3R)-3-cyano-4-imino-2-[(4-methylbenzoyl)amino]-2-(trifluoromethyl)pentanoate.
| Compound Name | methyl (2R,3R)-3-cyano-4-imino-2-[(4-methylbenzoyl)amino]-2-(trifluoromethyl)pentanoate |
|---|---|
| PubChem CID | 7289973 |
| Molecular Formula | C16H16F3N3O3 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | methyl (2R,3R)-3-cyano-4-imino-2-[(4-methylbenzoyl)amino]-2-(trifluoromethyl)pentanoate |
| SMILES | [H]/N=C(\C)[C@H](C#N)[C@@](NC(=O)c1ccc(C)cc1)(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C16H16F3N3O3/c1-9-4-6-11(7-5-9)13(23)22-15(14(24)25-3,16(17,18)19)12(8-20)10(2)21/h4-7,12,21H,1-3H3,(H,22,23)/b21-10+/t12-,15+/m0/s1 |
| InChIKey | LUGBPMWWVRXDDO-GRNKCENMSA-N |
| XLogP | 2.38 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|