C17H14F3O3P — CID 11862910
(1R)-2,2,2-trifluoro-1-[methoxy(2-phenylethynyl)phosphoryl]-1-phenylethanol (PubChem CID 11862910) has the molecular formula C17H14F3O3P and a molecular weight of 354.26 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-[methoxy(2-phenylethynyl)phosphoryl]-1-phenylethanol.
| Compound Name | (1R)-2,2,2-trifluoro-1-[methoxy(2-phenylethynyl)phosphoryl]-1-phenylethanol |
|---|---|
| PubChem CID | 11862910 |
| Molecular Formula | C17H14F3O3P |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-[methoxy(2-phenylethynyl)phosphoryl]-1-phenylethanol |
| SMILES | CO[P@@](=O)(C#Cc1ccccc1)[C@](O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H14F3O3P/c1-23-24(22,13-12-14-8-4-2-5-9-14)16(21,17(18,19)20)15-10-6-3-7-11-15/h2-11,21H,1H3/t16-,24+/m1/s1 |
| InChIKey | JETBBCIKNHGVGW-GYCJOSAFSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|