C16H23O3P — CID 11862925
(1S)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol (PubChem CID 11862925) has the molecular formula C16H23O3P and a molecular weight of 294.33 g/mol. Its IUPAC name is (1S)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol.
| Compound Name | (1S)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol |
|---|---|
| PubChem CID | 11862925 |
| Molecular Formula | C16H23O3P |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | (1S)-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol |
| SMILES | CCO[P@](=O)(C#CC(C)(C)C)[C@](C)(O)c1ccccc1 |
| InChI | InChI=1S/C16H23O3P/c1-6-19-20(18,13-12-15(2,3)4)16(5,17)14-10-8-7-9-11-14/h7-11,17H,6H2,1-5H3/t16-,20+/m0/s1 |
| InChIKey | NMGFULLYWKQAOP-OXJNMPFZSA-N |
| XLogP | 4.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|