C16H22BrO3P — CID 3831650
2-bromo-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol (PubChem CID 3831650) has the molecular formula C16H22BrO3P and a molecular weight of 373.23 g/mol. Its IUPAC name is 2-bromo-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol.
| Compound Name | 2-bromo-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol |
|---|---|
| PubChem CID | 3831650 |
| Molecular Formula | C16H22BrO3P |
| Molecular Weight | 373.23 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-bromo-1-[3,3-dimethylbut-1-ynyl(ethoxy)phosphoryl]-1-phenylethanol |
| SMILES | CCOP(=O)(C#CC(C)(C)C)C(O)(CBr)c1ccccc1 |
| InChI | InChI=1S/C16H22BrO3P/c1-5-20-21(19,12-11-15(2,3)4)16(18,13-17)14-9-7-6-8-10-14/h6-10,18H,5,13H2,1-4H3 |
| InChIKey | JALDDMRDFRGFKB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|