C17H18BrO3P — CID 11903863
(1R)-2-bromo-1-[methoxy-[(E)-2-phenylethenyl]phosphoryl]-1-phenylethanol (PubChem CID 11903863) has the molecular formula C17H18BrO3P and a molecular weight of 381.21 g/mol. Its IUPAC name is (1R)-2-bromo-1-[methoxy-[(E)-2-phenylethenyl]phosphoryl]-1-phenylethanol.
| Compound Name | (1R)-2-bromo-1-[methoxy-[(E)-2-phenylethenyl]phosphoryl]-1-phenylethanol |
|---|---|
| PubChem CID | 11903863 |
| Molecular Formula | C17H18BrO3P |
| Molecular Weight | 381.21 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (1R)-2-bromo-1-[methoxy-[(E)-2-phenylethenyl]phosphoryl]-1-phenylethanol |
| SMILES | CO[P@@](=O)(/C=C/c1ccccc1)[C@@](O)(CBr)c1ccccc1 |
| InChI | InChI=1S/C17H18BrO3P/c1-21-22(20,13-12-15-8-4-2-5-9-15)17(19,14-18)16-10-6-3-7-11-16/h2-13,19H,14H2,1H3/b13-12+/t17-,22-/m0/s1 |
| InChIKey | CCOABLICFLTEMZ-DVZBKKJASA-N |
| XLogP | 4.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.21 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|