C16H24NO5P — CID 11024294
N-[(E,2R,3S)-3-dimethoxyphosphoryl-2-hydroxy-6-phenylhex-5-en-3-yl]acetamide (PubChem CID 11024294) has the molecular formula C16H24NO5P and a molecular weight of 341.34 g/mol. Its IUPAC name is N-[(E,2R,3S)-3-dimethoxyphosphoryl-2-hydroxy-6-phenylhex-5-en-3-yl]acetamide.
| Compound Name | N-[(E,2R,3S)-3-dimethoxyphosphoryl-2-hydroxy-6-phenylhex-5-en-3-yl]acetamide |
|---|---|
| PubChem CID | 11024294 |
| Molecular Formula | C16H24NO5P |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N-[(E,2R,3S)-3-dimethoxyphosphoryl-2-hydroxy-6-phenylhex-5-en-3-yl]acetamide |
| SMILES | COP(=O)(OC)[C@](C/C=C/c1ccccc1)(NC(C)=O)[C@@H](C)O |
| InChI | InChI=1S/C16H24NO5P/c1-13(18)16(17-14(2)19,23(20,21-3)22-4)12-8-11-15-9-6-5-7-10-15/h5-11,13,18H,12H2,1-4H3,(H,17,19)/b11-8+/t13-,16+/m1/s1 |
| InChIKey | XSRFPGHGQOVMGB-HDEOUBMNSA-N |
| XLogP | 2.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|