C13H17O6P — CID 71682922
[(E,1R)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl] methyl carbonate (PubChem CID 71682922) has the molecular formula C13H17O6P and a molecular weight of 300.25 g/mol. Its IUPAC name is [(E,1R)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl] methyl carbonate.
| Compound Name | [(E,1R)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 71682922 |
| Molecular Formula | C13H17O6P |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | [(E,1R)-1-dimethoxyphosphoryl-3-phenylprop-2-enyl] methyl carbonate |
| SMILES | COC(=O)O[C@@H](/C=C/c1ccccc1)P(=O)(OC)OC |
| InChI | InChI=1S/C13H17O6P/c1-16-13(14)19-12(20(15,17-2)18-3)10-9-11-7-5-4-6-8-11/h4-10,12H,1-3H3/b10-9+/t12-/m1/s1 |
| InChIKey | XWFIADOVHUSPHI-BZYZDCJZSA-N |
| XLogP | 3.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|