C21H23NS — CID 143864098
2-[(3Z)-2-methylidene-1,1-diphenylhexa-3,5-dienyl]sulfanylethanamine (PubChem CID 143864098) has the molecular formula C21H23NS and a molecular weight of 321.49 g/mol. Its IUPAC name is 2-[(3Z)-2-methylidene-1,1-diphenylhexa-3,5-dienyl]sulfanylethanamine.
| Compound Name | 2-[(3Z)-2-methylidene-1,1-diphenylhexa-3,5-dienyl]sulfanylethanamine |
|---|---|
| PubChem CID | 143864098 |
| Molecular Formula | C21H23NS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-[(3Z)-2-methylidene-1,1-diphenylhexa-3,5-dienyl]sulfanylethanamine |
| SMILES | C=C/C=C\C(=C)C(SCCN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H23NS/c1-3-4-11-18(2)21(23-17-16-22,19-12-7-5-8-13-19)20-14-9-6-10-15-20/h3-15H,1-2,16-17,22H2/b11-4- |
| InChIKey | BMBJLKZMYCHTDY-WCIBSUBMSA-N |
| XLogP | 4.92 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|