About [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene
[(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene (PubChem CID 58734719) has the molecular formula C12H12I-
and a molecular weight of 283.13 g/mol. Its IUPAC name is [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene.
Molecular Properties
| Compound Name | [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene |
| PubChem CID | 58734719 |
| Molecular Formula | C12H12I- |
| Molecular Weight | 283.13 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene |
| SMILES | C=C/C=C\C(=C)[I-]c1ccccc1 |
| InChI | InChI=1S/C12H12I/c1-3-4-8-11(2)13-12-9-6-5-7-10-12/h3-10H,1-2H2/q-1/b8-4- |
| InChIKey | OIPWVZVWAFWETG-YWEYNIOJSA-N |
| XLogP | 0.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.13 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene?
The IUPAC name of [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene (CID 58734719) is [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene.
What is the SMILES notation for [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene?
The canonical SMILES for [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene is C=C/C=C\C(=C)[I-]c1ccccc1.
What is the InChIKey of [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene?
The InChIKey is OIPWVZVWAFWETG-YWEYNIOJSA-N. The full InChI is InChI=1S/C12H12I/c1-3-4-8-11(2)13-12-9-6-5-7-10-12/h3-10H,1-2H2/q-1/b8-4-.
What are the key properties of [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene?
[(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene has a molecular weight of 283.13 g/mol, XLogP of 0.20, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-hexa-1,3,5-trien-2-yl]iodanuidylbenzene is sourced from PubChem (CID 58734719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).