C9H11NO5 — CID 88706863
cyclobutene-1,2-dicarboxylic acid;prop-2-enamide (PubChem CID 88706863) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is cyclobutene-1,2-dicarboxylic acid;prop-2-enamide.
| Compound Name | cyclobutene-1,2-dicarboxylic acid;prop-2-enamide |
|---|---|
| PubChem CID | 88706863 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | cyclobutene-1,2-dicarboxylic acid;prop-2-enamide |
| SMILES | C=CC(N)=O.O=C(O)C1=C(C(=O)O)CC1 |
| InChI | InChI=1S/C6H6O4.C3H5NO/c7-5(8)3-1-2-4(3)6(9)10;1-2-3(4)5/h1-2H2,(H,7,8)(H,9,10);2H,1H2,(H2,4,5) |
| InChIKey | DVXOCXDZHUPKAC-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|