About tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate
tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate (PubChem CID 164717697) has the molecular formula C23H21O4S+
and a molecular weight of 393.48 g/mol. Its IUPAC name is tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate.
Molecular Properties
| Compound Name | tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate |
| PubChem CID | 164717697 |
| Molecular Formula | C23H21O4S+ |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc([S+]2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C23H21O4S/c1-23(2,3)27-22(24)25-16-12-14-17(15-13-16)28-20-10-6-4-8-18(20)26-19-9-5-7-11-21(19)28/h4-15H,1-3H3/q+1 |
| InChIKey | WXADOALVKGJZKO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate?
The IUPAC name of tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate (CID 164717697) is tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate.
What is the SMILES notation for tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate?
The canonical SMILES for tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate is CC(C)(C)OC(=O)Oc1ccc([S+]2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate?
The InChIKey is WXADOALVKGJZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21O4S/c1-23(2,3)27-22(24)25-16-12-14-17(15-13-16)28-20-10-6-4-8-18(20)26-19-9-5-7-11-21(19)28/h4-15H,1-3H3/q+1.
What are the key properties of tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate?
tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate has a molecular weight of 393.48 g/mol, XLogP of 6.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4-phenoxathiin-10-ium-10-ylphenyl) carbonate is sourced from PubChem (CID 164717697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).