C40H36O3 — CID 150001889
tert-butyl 2-[4-(9,10-diphenylanthracen-1-yl)-2,6-dimethylphenoxy]acetate (PubChem CID 150001889) has the molecular formula C40H36O3 and a molecular weight of 564.73 g/mol. Its IUPAC name is tert-butyl 2-[4-(9,10-diphenylanthracen-1-yl)-2,6-dimethylphenoxy]acetate.
| Compound Name | tert-butyl 2-[4-(9,10-diphenylanthracen-1-yl)-2,6-dimethylphenoxy]acetate |
|---|---|
| PubChem CID | 150001889 |
| Molecular Formula | C40H36O3 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | tert-butyl 2-[4-(9,10-diphenylanthracen-1-yl)-2,6-dimethylphenoxy]acetate |
| SMILES | Cc1cc(-c2cccc3c(-c4ccccc4)c4ccccc4c(-c4ccccc4)c23)cc(C)c1OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H36O3/c1-26-23-30(24-27(2)39(26)42-25-35(41)43-40(3,4)5)31-21-14-22-34-36(28-15-8-6-9-16-28)32-19-12-13-20-33(32)37(38(31)34)29-17-10-7-11-18-29/h6-24H,25H2,1-5H3 |
| InChIKey | DBLVBAVENCESDH-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|