C24H30O5 — CID 176725515
[3-(2-hydroxypropan-2-yl)phenyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 176725515) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is [3-(2-hydroxypropan-2-yl)phenyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | [3-(2-hydroxypropan-2-yl)phenyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 176725515 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | [3-(2-hydroxypropan-2-yl)phenyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)Oc1cccc(C(C)(C)O)c1)(C3)C2 |
| InChI | InChI=1S/C24H30O5/c1-15(2)20(25)29-24-12-16-8-17(13-24)11-23(10-16,14-24)21(26)28-19-7-5-6-18(9-19)22(3,4)27/h5-7,9,16-17,27H,1,8,10-14H2,2-4H3 |
| InChIKey | XTPQYXXJBRCPOH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|