C20H26F9NO9S3 — CID 88542744
[3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxy-1-adamantyl] 2,2-dimethylbutanoate (PubChem CID 88542744) has the molecular formula C20H26F9NO9S3 and a molecular weight of 691.61 g/mol. Its IUPAC name is [3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxy-1-adamantyl] 2,2-dimethylbutanoate.
| Compound Name | [3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxy-1-adamantyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 88542744 |
| Molecular Formula | C20H26F9NO9S3 |
| Molecular Weight | 691.61 g/mol |
| Exact Mass | 691.06 |
| IUPAC Name | [3-[1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylsulfamoyl)propyl]sulfonyloxy-1-adamantyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(C1)CC(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)NS(=O)(=O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C20H26F9NO9S3/c1-4-14(2,3)13(31)38-15-6-11-5-12(7-15)9-16(8-11,10-15)39-42(36,37)19(25,26)17(21,22)18(23,24)40(32,33)30-41(34,35)20(27,28)29/h11-12,30H,4-10H2,1-3H3 |
| InChIKey | UOAKITNPOAJDEX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.61 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|