C20H30F3NO5S — CID 154963948
[3-(trifluoromethylsulfonylcarbamoyl)-1-adamantyl] 2,2,3,3-tetramethylbutanoate (PubChem CID 154963948) has the molecular formula C20H30F3NO5S and a molecular weight of 453.52 g/mol. Its IUPAC name is [3-(trifluoromethylsulfonylcarbamoyl)-1-adamantyl] 2,2,3,3-tetramethylbutanoate.
| Compound Name | [3-(trifluoromethylsulfonylcarbamoyl)-1-adamantyl] 2,2,3,3-tetramethylbutanoate |
|---|---|
| PubChem CID | 154963948 |
| Molecular Formula | C20H30F3NO5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | [3-(trifluoromethylsulfonylcarbamoyl)-1-adamantyl] 2,2,3,3-tetramethylbutanoate |
| SMILES | CC(C)(C)C(C)(C)C(=O)OC12CC3CC(C1)CC(C(=O)NS(=O)(=O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C20H30F3NO5S/c1-16(2,3)17(4,5)15(26)29-19-9-12-6-13(10-19)8-18(7-12,11-19)14(25)24-30(27,28)20(21,22)23/h12-13H,6-11H2,1-5H3,(H,24,25) |
| InChIKey | IRRGSHGQPLDJNS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |