C14H18F5NO3S — CID 161272172
N-(1,1,3,3,3-pentafluoropropylsulfonyl)adamantane-1-carboxamide (PubChem CID 161272172) has the molecular formula C14H18F5NO3S and a molecular weight of 375.36 g/mol. Its IUPAC name is N-(1,1,3,3,3-pentafluoropropylsulfonyl)adamantane-1-carboxamide.
| Compound Name | N-(1,1,3,3,3-pentafluoropropylsulfonyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 161272172 |
| Molecular Formula | C14H18F5NO3S |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(1,1,3,3,3-pentafluoropropylsulfonyl)adamantane-1-carboxamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)CC(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H18F5NO3S/c15-13(16,17)7-14(18,19)24(22,23)20-11(21)12-4-8-1-9(5-12)3-10(2-8)6-12/h8-10H,1-7H2,(H,20,21) |
| InChIKey | INZYZNPUAJEIPF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |