C17H22F3NO4 — CID 163871504
[3-(acetylcarbamoyl)-1-adamantyl] 3,3,3-trifluoro-2-methylpropanoate (PubChem CID 163871504) has the molecular formula C17H22F3NO4 and a molecular weight of 361.36 g/mol. Its IUPAC name is [3-(acetylcarbamoyl)-1-adamantyl] 3,3,3-trifluoro-2-methylpropanoate.
| Compound Name | [3-(acetylcarbamoyl)-1-adamantyl] 3,3,3-trifluoro-2-methylpropanoate |
|---|---|
| PubChem CID | 163871504 |
| Molecular Formula | C17H22F3NO4 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | [3-(acetylcarbamoyl)-1-adamantyl] 3,3,3-trifluoro-2-methylpropanoate |
| SMILES | CC(=O)NC(=O)C12CC3CC(CC(OC(=O)C(C)C(F)(F)F)(C3)C1)C2 |
| InChI | InChI=1S/C17H22F3NO4/c1-9(17(18,19)20)13(23)25-16-6-11-3-12(7-16)5-15(4-11,8-16)14(24)21-10(2)22/h9,11-12H,3-8H2,1-2H3,(H,21,22,24) |
| InChIKey | LKZKBNFSZXVWPK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |