C22H35INO4+ — CID 162508345
2-piperidin-1-ium-4-ylpropan-2-yl 3-(2-iodopropanoyloxy)adamantane-1-carboxylate (PubChem CID 162508345) has the molecular formula C22H35INO4+ and a molecular weight of 504.43 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 3-(2-iodopropanoyloxy)adamantane-1-carboxylate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-(2-iodopropanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 162508345 |
| Molecular Formula | C22H35INO4+ |
| Molecular Weight | 504.43 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-(2-iodopropanoyloxy)adamantane-1-carboxylate |
| SMILES | CC(I)C(=O)OC12CC3CC(C1)CC(C(=O)OC(C)(C)C1CC[NH2+]CC1)(C3)C2 |
| InChI | InChI=1S/C22H34INO4/c1-14(23)18(25)27-22-11-15-8-16(12-22)10-21(9-15,13-22)19(26)28-20(2,3)17-4-6-24-7-5-17/h14-17,24H,4-13H2,1-3H3/p+1 |
| InChIKey | WAMDTWHLUZIBOS-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|