About (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate
(4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate (PubChem CID 162508248) has the molecular formula C25H32INO4
and a molecular weight of 537.44 g/mol. Its IUPAC name is (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate.
Molecular Properties
| Compound Name | (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate |
| PubChem CID | 162508248 |
| Molecular Formula | C25H32INO4 |
| Molecular Weight | 537.44 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate |
| SMILES | CC(I)C(=O)OC12CC3CC(C1)CC(C(=O)OC1(c4ccccc4)CCNCC1)(C3)C2 |
| InChI | InChI=1S/C25H32INO4/c1-17(26)21(28)30-24-14-18-11-19(15-24)13-23(12-18,16-24)22(29)31-25(7-9-27-10-8-25)20-5-3-2-4-6-20/h2-6,17-19,27H,7-16H2,1H3 |
| InChIKey | KZAZPSWDSMJGLQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 537.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate?
The IUPAC name of (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate (CID 162508248) is (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate.
What is the SMILES notation for (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate?
The canonical SMILES for (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate is CC(I)C(=O)OC12CC3CC(C1)CC(C(=O)OC1(c4ccccc4)CCNCC1)(C3)C2.
What is the InChIKey of (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate?
The InChIKey is KZAZPSWDSMJGLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32INO4/c1-17(26)21(28)30-24-14-18-11-19(15-24)13-23(12-18,16-24)22(29)31-25(7-9-27-10-8-25)20-5-3-2-4-6-20/h2-6,17-19,27H,7-16H2,1H3.
What are the key properties of (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate?
(4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate has a molecular weight of 537.44 g/mol, XLogP of 4.51, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylpiperidin-4-yl) 3-(2-iodopropanoyloxy)adamantane-1-carboxylate is sourced from PubChem (CID 162508248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).