C13H18F3NO4S — CID 123322608
[3-(trifluoromethylsulfonylamino)-1-adamantyl] acetate (PubChem CID 123322608) has the molecular formula C13H18F3NO4S and a molecular weight of 341.35 g/mol. Its IUPAC name is [3-(trifluoromethylsulfonylamino)-1-adamantyl] acetate.
| Compound Name | [3-(trifluoromethylsulfonylamino)-1-adamantyl] acetate |
|---|---|
| PubChem CID | 123322608 |
| Molecular Formula | C13H18F3NO4S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | [3-(trifluoromethylsulfonylamino)-1-adamantyl] acetate |
| SMILES | CC(=O)OC12CC3CC(CC(NS(=O)(=O)C(F)(F)F)(C3)C1)C2 |
| InChI | InChI=1S/C13H18F3NO4S/c1-8(18)21-12-5-9-2-10(6-12)4-11(3-9,7-12)17-22(19,20)13(14,15)16/h9-10,17H,2-7H2,1H3 |
| InChIKey | ZBRVHGVSAQJPAP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |