C44H70O9 — CID 20622083
3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(oxan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20622083) has the molecular formula C44H70O9 and a molecular weight of 743.03 g/mol. Its IUPAC name is 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(oxan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(oxan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20622083 |
| Molecular Formula | C44H70O9 |
| Molecular Weight | 743.03 g/mol |
| Exact Mass | 742.50 |
| IUPAC Name | 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(oxan-2-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1CCCCO1)C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(=O)OC(C)(C(C)C)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C44H70O9/c1-9-38(6,35(46)52-40(8,28(2)3)41-16-29-14-30(17-41)19-42(48,18-29)26-41)25-39(7,24-37(4,5)34(45)51-33-12-10-11-13-50-33)36(47)53-44-22-31-15-32(23-44)21-43(49,20-31)27-44/h28-33,48-49H,9-27H2,1-8H3 |
| InChIKey | WFIMDJVFZCTRMQ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.03 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|