C43H66O10 — CID 22964829
1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)propan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 22964829) has the molecular formula C43H66O10 and a molecular weight of 742.99 g/mol. Its IUPAC name is 1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)propan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)propan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 22964829 |
| Molecular Formula | C43H66O10 |
| Molecular Weight | 742.99 g/mol |
| Exact Mass | 742.47 |
| IUPAC Name | 1-O-(2,2-dimethyl-5-oxooxolan-3-yl) 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)propan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1CC(=O)OC1(C)C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(=O)OC(C)(C)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C43H66O10/c1-10-38(8,33(46)52-37(6,7)40-14-26-11-27(15-40)17-41(48,16-26)24-40)23-39(9,22-35(2,3)32(45)50-30-13-31(44)51-36(30,4)5)34(47)53-43-20-28-12-29(21-43)19-42(49,18-28)25-43/h26-30,48-49H,10-25H2,1-9H3 |
| InChIKey | JEHGUNHUSKRJIV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.99 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|