About 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate
5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate (PubChem CID 20675708) has the molecular formula C16H26O8S
and a molecular weight of 378.44 g/mol. Its IUPAC name is 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate.
Molecular Properties
| Compound Name | 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate |
| PubChem CID | 20675708 |
| Molecular Formula | C16H26O8S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate |
| SMILES | CCC(C)(CC(C)C(=O)OS(=O)OC)C(=O)OC1(C)CCOC(=O)C1 |
| InChI | InChI=1S/C16H26O8S/c1-6-15(3,9-11(2)13(18)24-25(20)21-5)14(19)23-16(4)7-8-22-12(17)10-16/h11H,6-10H2,1-5H3 |
| InChIKey | DVHOSCPGEBIQEU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate?
The IUPAC name of 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate (CID 20675708) is 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate.
What is the SMILES notation for 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate?
The canonical SMILES for 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate is CCC(C)(CC(C)C(=O)OS(=O)OC)C(=O)OC1(C)CCOC(=O)C1.
What is the InChIKey of 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate?
The InChIKey is DVHOSCPGEBIQEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O8S/c1-6-15(3,9-11(2)13(18)24-25(20)21-5)14(19)23-16(4)7-8-22-12(17)10-16/h11H,6-10H2,1-5H3.
What are the key properties of 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate?
5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate has a molecular weight of 378.44 g/mol, XLogP of 1.84, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-methoxysulfinyl 1-O-(4-methyl-2-oxooxan-4-yl) 2-ethyl-2,4-dimethylpentanedioate is sourced from PubChem (CID 20675708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).