C9H12I2N2O4 — CID 152945948
(4-methyl-2-oxooxan-4-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate (PubChem CID 152945948) has the molecular formula C9H12I2N2O4 and a molecular weight of 466.01 g/mol. Its IUPAC name is (4-methyl-2-oxooxan-4-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate.
| Compound Name | (4-methyl-2-oxooxan-4-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
|---|---|
| PubChem CID | 152945948 |
| Molecular Formula | C9H12I2N2O4 |
| Molecular Weight | 466.01 g/mol |
| Exact Mass | 465.89 |
| IUPAC Name | (4-methyl-2-oxooxan-4-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
| SMILES | CC1(OC(=O)C(I)C23NI2N3)CCOC(=O)C1 |
| InChI | InChI=1S/C9H12I2N2O4/c1-8(2-3-16-5(14)4-8)17-7(15)6(10)9-11(12-9)13-9/h6,12-13H,2-4H2,1H3 |
| InChIKey | UNTCYQLLPDJUFG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.01 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|