C13H20I2N2O3 — CID 154559870
(3-methyl-2-oxaspiro[4.5]decan-1-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate (PubChem CID 154559870) has the molecular formula C13H20I2N2O3 and a molecular weight of 506.12 g/mol. Its IUPAC name is (3-methyl-2-oxaspiro[4.5]decan-1-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate.
| Compound Name | (3-methyl-2-oxaspiro[4.5]decan-1-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
|---|---|
| PubChem CID | 154559870 |
| Molecular Formula | C13H20I2N2O3 |
| Molecular Weight | 506.12 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | (3-methyl-2-oxaspiro[4.5]decan-1-yl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
| SMILES | CC1CC2(CCCCC2)C(OC(=O)C(I)C23NI2N3)O1 |
| InChI | InChI=1S/C13H20I2N2O3/c1-8-7-12(5-3-2-4-6-12)11(19-8)20-10(18)9(14)13-15(16-13)17-13/h8-9,11,16-17H,2-7H2,1H3 |
| InChIKey | ABEZZEKLIDJQSJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|