C14H22I2N2O2 — CID 146813826
(5-ethyl-1,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate (PubChem CID 146813826) has the molecular formula C14H22I2N2O2 and a molecular weight of 504.15 g/mol. Its IUPAC name is (5-ethyl-1,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate.
| Compound Name | (5-ethyl-1,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
|---|---|
| PubChem CID | 146813826 |
| Molecular Formula | C14H22I2N2O2 |
| Molecular Weight | 504.15 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | (5-ethyl-1,6,6-trimethyl-5-bicyclo[2.1.1]hexanyl) 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
| SMILES | CCC1(OC(=O)C(I)C23NI2N3)C2CCC1(C)C2(C)C |
| InChI | InChI=1S/C14H22I2N2O2/c1-5-13(8-6-7-12(13,4)11(8,2)3)20-10(19)9(15)14-16(17-14)18-14/h8-9,17-18H,5-7H2,1-4H3 |
| InChIKey | SARLMCKQGBUYDS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|