C8H16I2N2O3 — CID 163787958
ethoxymethyl 2-(dimethyl-λ3-iodanyl)-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate (PubChem CID 163787958) has the molecular formula C8H16I2N2O3 and a molecular weight of 442.04 g/mol. Its IUPAC name is ethoxymethyl 2-(dimethyl-λ3-iodanyl)-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate.
| Compound Name | ethoxymethyl 2-(dimethyl-λ3-iodanyl)-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
|---|---|
| PubChem CID | 163787958 |
| Molecular Formula | C8H16I2N2O3 |
| Molecular Weight | 442.04 g/mol |
| Exact Mass | 441.93 |
| IUPAC Name | ethoxymethyl 2-(dimethyl-λ3-iodanyl)-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
| SMILES | CCOCOC(=O)C(I(C)C)C12NI1N2 |
| InChI | InChI=1S/C8H16I2N2O3/c1-4-14-5-15-7(13)6(9(2)3)8-10(11-8)12-8/h6,11-12H,4-5H2,1-3H3 |
| InChIKey | MUEPXCZNNIKCDG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.04 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|