C15H25O17S3-3 — CID 167622860
2-(ethoxymethoxy)-2-oxoethanesulfonate;2-ethoxy-2-oxoethanesulfonate;2-oxo-2-(2-oxobutoxy)ethanesulfonate (PubChem CID 167622860) has the molecular formula C15H25O17S3-3 and a molecular weight of 573.55 g/mol. Its IUPAC name is 2-(ethoxymethoxy)-2-oxoethanesulfonate;2-ethoxy-2-oxoethanesulfonate;2-oxo-2-(2-oxobutoxy)ethanesulfonate.
| Compound Name | 2-(ethoxymethoxy)-2-oxoethanesulfonate;2-ethoxy-2-oxoethanesulfonate;2-oxo-2-(2-oxobutoxy)ethanesulfonate |
|---|---|
| PubChem CID | 167622860 |
| Molecular Formula | C15H25O17S3-3 |
| Molecular Weight | 573.55 g/mol |
| Exact Mass | 573.03 |
| IUPAC Name | 2-(ethoxymethoxy)-2-oxoethanesulfonate;2-ethoxy-2-oxoethanesulfonate;2-oxo-2-(2-oxobutoxy)ethanesulfonate |
| SMILES | CCC(=O)COC(=O)CS(=O)(=O)[O-].CCOC(=O)CS(=O)(=O)[O-].CCOCOC(=O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H10O6S.C5H10O6S.C4H8O5S/c1-2-5(7)3-12-6(8)4-13(9,10)11;1-2-10-4-11-5(6)3-12(7,8)9;1-2-9-4(5)3-10(6,7)8/h2-4H2,1H3,(H,9,10,11);2-4H2,1H3,(H,7,8,9);2-3H2,1H3,(H,6,7,8)/p-3 |
| InChIKey | MRMMAMUFSATREO-UHFFFAOYSA-K |
| XLogP | -2.78 |
| TPSA | 276.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.55 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|