C13H25O5S- — CID 91589235
bicyclo[2.2.1]heptane;ethane;2-ethoxy-2-oxoethanesulfonate (PubChem CID 91589235) has the molecular formula C13H25O5S- and a molecular weight of 293.40 g/mol. Its IUPAC name is bicyclo[2.2.1]heptane;ethane;2-ethoxy-2-oxoethanesulfonate.
| Compound Name | bicyclo[2.2.1]heptane;ethane;2-ethoxy-2-oxoethanesulfonate |
|---|---|
| PubChem CID | 91589235 |
| Molecular Formula | C13H25O5S- |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | bicyclo[2.2.1]heptane;ethane;2-ethoxy-2-oxoethanesulfonate |
| SMILES | C1CC2CCC1C2.CC.CCOC(=O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H12.C4H8O5S.C2H6/c1-2-7-4-3-6(1)5-7;1-2-9-4(5)3-10(6,7)8;1-2/h6-7H,1-5H2;2-3H2,1H3,(H,6,7,8);1-2H3/p-1 |
| InChIKey | MIHHNPQUVBJEBF-UHFFFAOYSA-M |
| XLogP | 2.32 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|