C12H20I2N2O3 — CID 154469725
(1-methylcyclohexyl)methoxymethyl 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate (PubChem CID 154469725) has the molecular formula C12H20I2N2O3 and a molecular weight of 494.11 g/mol. Its IUPAC name is (1-methylcyclohexyl)methoxymethyl 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate.
| Compound Name | (1-methylcyclohexyl)methoxymethyl 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
|---|---|
| PubChem CID | 154469725 |
| Molecular Formula | C12H20I2N2O3 |
| Molecular Weight | 494.11 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | (1-methylcyclohexyl)methoxymethyl 2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetate |
| SMILES | CC1(COCOC(=O)C(I)C23NI2N3)CCCCC1 |
| InChI | InChI=1S/C12H20I2N2O3/c1-11(5-3-2-4-6-11)7-18-8-19-10(17)9(13)12-14(15-12)16-12/h9,15-16H,2-8H2,1H3 |
| InChIKey | AWTKXBDHMOVTTL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.11 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|