C18H24I2N2O6 — CID 147906300
(1-methylcyclopentyl) 2-[2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetyl]oxy-6-methyl-4-oxo-3-oxabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 147906300) has the molecular formula C18H24I2N2O6 and a molecular weight of 618.21 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2-[2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetyl]oxy-6-methyl-4-oxo-3-oxabicyclo[3.2.1]octane-8-carboxylate.
| Compound Name | (1-methylcyclopentyl) 2-[2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetyl]oxy-6-methyl-4-oxo-3-oxabicyclo[3.2.1]octane-8-carboxylate |
|---|---|
| PubChem CID | 147906300 |
| Molecular Formula | C18H24I2N2O6 |
| Molecular Weight | 618.21 g/mol |
| Exact Mass | 617.97 |
| IUPAC Name | (1-methylcyclopentyl) 2-[2-iodo-2-(1λ3-ioda-2,4-diazabicyclo[1.1.0]butan-3-yl)acetyl]oxy-6-methyl-4-oxo-3-oxabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC1CC2C(OC(=O)C(I)C34NI3N4)OC(=O)C1C2C(=O)OC1(C)CCCC1 |
| InChI | InChI=1S/C18H24I2N2O6/c1-8-7-9-11(14(24)28-17(2)5-3-4-6-17)10(8)13(23)26-16(9)27-15(25)12(19)18-20(21-18)22-18/h8-12,16,21-22H,3-7H2,1-2H3 |
| InChIKey | IFGJDLAFNCDBLR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 122.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|