C20H25BI2NO6 — CID 149113185
CID 149113185 (PubChem CID 149113185) has the molecular formula C20H25BI2NO6 and a molecular weight of 640.04 g/mol.
| Compound Name | CID 149113185 |
|---|---|
| PubChem CID | 149113185 |
| Molecular Formula | C20H25BI2NO6 |
| Molecular Weight | 640.04 g/mol |
| Exact Mass | 639.99 |
| IUPAC Name | — |
| SMILES | CC1(OC(=O)C2C3CC4C(OC(=O)C42)C3OC(=O)C(C)(I)C23[B]I2N3)CCCCC1 |
| InChI | InChI=1S/C20H25BI2NO6/c1-18(6-4-3-5-7-18)30-16(26)12-10-8-9-11(12)15(25)28-13(9)14(10)29-17(27)19(2,22)20-21-23(20)24-20/h9-14,24H,3-8H2,1-2H3 |
| InChIKey | RKPBQISPXGQXTR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.04 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|