C18H20B2I2O6 — CID 149212709
CID 149212709 (PubChem CID 149212709) has the molecular formula C18H20B2I2O6 and a molecular weight of 607.78 g/mol.
| Compound Name | CID 149212709 |
|---|---|
| PubChem CID | 149212709 |
| Molecular Formula | C18H20B2I2O6 |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.95 |
| IUPAC Name | — |
| SMILES | CC(I)(C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OC1CCCC1)C12[B]I1[B]2 |
| InChI | InChI=1S/C18H20B2I2O6/c1-17(21,18-19-22(18)20-18)16(25)28-13-9-6-8-11(15(24)27-12(8)13)10(9)14(23)26-7-4-2-3-5-7/h7-13H,2-6H2,1H3 |
| InChIKey | WCKILHYXJGGHOW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|