C19H22B2I2O6- — CID 146891305
CID 146891305 (PubChem CID 146891305) has the molecular formula C19H22B2I2O6- and a molecular weight of 621.81 g/mol.
| Compound Name | CID 146891305 |
|---|---|
| PubChem CID | 146891305 |
| Molecular Formula | C19H22B2I2O6- |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.97 |
| IUPAC Name | — |
| SMILES | [B]C1(C(C)(I)C(=O)OC2C3CC4C2OC(=O)C4C3C(=O)OC2CCCCC2)[B][I-]1 |
| InChI | InChI=1S/C19H22B2I2O6/c1-18(22,19(20)21-23-19)17(26)29-14-10-7-9-12(16(25)28-13(9)14)11(10)15(24)27-8-5-3-2-4-6-8/h8-14H,2-7H2,1H3/q-1 |
| InChIKey | LKHIXPVYXSPNNF-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|