C24H32F2O7 — CID 58264780
[2-ethyl-5-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]-2-adamantyl] 2,2-difluoropropanoate (PubChem CID 58264780) has the molecular formula C24H32F2O7 and a molecular weight of 470.51 g/mol. Its IUPAC name is [2-ethyl-5-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]-2-adamantyl] 2,2-difluoropropanoate.
| Compound Name | [2-ethyl-5-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]-2-adamantyl] 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 58264780 |
| Molecular Formula | C24H32F2O7 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [2-ethyl-5-[2-oxo-2-[(7-oxo-6-oxabicyclo[3.2.1]octan-4-yl)oxy]ethoxy]-2-adamantyl] 2,2-difluoropropanoate |
| SMILES | CCC1(OC(=O)C(C)(F)F)C2CC3CC1CC(OCC(=O)OC1CCC4CC1OC4=O)(C3)C2 |
| InChI | InChI=1S/C24H32F2O7/c1-3-24(33-21(29)22(2,25)26)15-6-13-7-16(24)11-23(9-13,10-15)30-12-19(27)31-17-5-4-14-8-18(17)32-20(14)28/h13-18H,3-12H2,1-2H3 |
| InChIKey | OQBBGJKIMQFRNB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|